C25H24Cl3NO2 — CID 25004367
4-(4-chlorophenyl)-2-(cyclobutanecarbonyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 25004367) has the molecular formula C25H24Cl3NO2 and a molecular weight of 476.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(cyclobutanecarbonyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-2-(cyclobutanecarbonyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25004367 |
| Molecular Formula | C25H24Cl3NO2 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(cyclobutanecarbonyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | O=C(C1CCC1)N1CC2C(CCC(c3ccc(Cl)cc3Cl)C2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H24Cl3NO2/c26-16-6-4-14(5-7-16)23-19(18-9-8-17(27)12-22(18)28)10-11-20-21(23)13-29(25(20)31)24(30)15-2-1-3-15/h4-9,12,15,19-21,23H,1-3,10-11,13H2 |
| InChIKey | JQHDOJCCNJWHKV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|