C31H38FN2O3+ — CID 25004521
(R)-cyclohexyl-[5-[[3-[(4-fluorophenoxy)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol (PubChem CID 25004521) has the molecular formula C31H38FN2O3+ and a molecular weight of 505.65 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[3-[(4-fluorophenoxy)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[[3-[(4-fluorophenoxy)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 25004521 |
| Molecular Formula | C31H38FN2O3+ |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (R)-cyclohexyl-[5-[[3-[(4-fluorophenoxy)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)C(COc2ccc(F)cc2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C31H38FN2O3/c32-27-11-13-28(14-12-27)36-22-24-20-34(17-15-23(24)16-18-34)21-29-19-33-30(37-29)31(35,25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1,3-4,7-8,11-14,19,23-24,26,35H,2,5-6,9-10,15-18,20-22H2/q+1/t23?,24?,31-,34?/m0/s1 |
| InChIKey | XQWLKJOCAWZELM-JGDCNOFJSA-N |
| XLogP | 6.07 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|