C24H22ClNO6 — CID 25005457
(Z)-6-[(2S,4S,5R)-2-(6-chloro-4-oxochromen-3-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 25005457) has the molecular formula C24H22ClNO6 and a molecular weight of 455.89 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-2-(6-chloro-4-oxochromen-3-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-2-(6-chloro-4-oxochromen-3-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 25005457 |
| Molecular Formula | C24H22ClNO6 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-2-(6-chloro-4-oxochromen-3-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2coc3ccc(Cl)cc3c2=O)O[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C24H22ClNO6/c25-17-8-9-20-18(11-17)22(29)19(14-30-20)24-31-13-16(5-2-1-3-7-21(27)28)23(32-24)15-6-4-10-26-12-15/h1-2,4,6,8-12,14,16,23-24H,3,5,7,13H2,(H,27,28)/b2-1-/t16-,23-,24+/m1/s1 |
| InChIKey | JZXKREMPRRUTCL-ARMPIGRESA-N |
| XLogP | 5.06 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|