C21H27N3O3S — CID 25005580
4-[4-[cyclohexyl(methyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoic acid (PubChem CID 25005580) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-[4-[cyclohexyl(methyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[cyclohexyl(methyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 25005580 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[4-[cyclohexyl(methyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoic acid |
| SMILES | CCCSc1c(C(=O)N(C)C2CCCCC2)cnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-3-13-28-20-18(19(25)23(2)16-7-5-4-6-8-16)14-22-24(20)17-11-9-15(10-12-17)21(26)27/h9-12,14,16H,3-8,13H2,1-2H3,(H,26,27) |
| InChIKey | BICVKEYNPZYVKI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |