C26H32BrClN2O3 — CID 25005584
2-(4-chlorophenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium bromide (PubChem CID 25005584) has the molecular formula C26H32BrClN2O3 and a molecular weight of 535.91 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium bromide.
| Compound Name | 2-(4-chlorophenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 25005584 |
| Molecular Formula | C26H32BrClN2O3 |
| Molecular Weight | 535.91 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium bromide |
| SMILES | C[N+](C)(CCOc1ccc(Cl)cc1)Cc1cnc(C(O)(c2ccccc2)C2CCCC2)o1.[Br-] |
| InChI | InChI=1S/C26H32ClN2O3.BrH/c1-29(2,16-17-31-23-14-12-22(27)13-15-23)19-24-18-28-25(32-24)26(30,21-10-6-7-11-21)20-8-4-3-5-9-20;/h3-5,8-9,12-15,18,21,30H,6-7,10-11,16-17,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UFDUYRVRDOPIAU-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|