About [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate
[5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate (PubChem CID 25005834) has the molecular formula C17H18FN3O2S
and a molecular weight of 347.42 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate |
| PubChem CID | 25005834 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate |
| SMILES | O=C(NC12CCN(CC1)CC2)Oc1ncsc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O2S/c18-13-3-1-12(2-4-13)14-15(19-11-24-14)23-16(22)20-17-5-8-21(9-6-17)10-7-17/h1-4,11H,5-10H2,(H,20,22) |
| InChIKey | JCGXHEQEIARZAA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate?
The IUPAC name of [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate (CID 25005834) is [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate.
What is the SMILES notation for [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate?
The canonical SMILES for [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate is O=C(NC12CCN(CC1)CC2)Oc1ncsc1-c1ccc(F)cc1.
What is the InChIKey of [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate?
The InChIKey is JCGXHEQEIARZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O2S/c18-13-3-1-12(2-4-13)14-15(19-11-24-14)23-16(22)20-17-5-8-21(9-6-17)10-7-17/h1-4,11H,5-10H2,(H,20,22).
What are the key properties of [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate?
[5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate has a molecular weight of 347.42 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-1,3-thiazol-4-yl] N-(1-azabicyclo[2.2.2]octan-4-yl)carbamate is sourced from PubChem (CID 25005834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).