C38H37FN2O6S — CID 25005872
(2,2-dimethyl-3H-1-benzofuran-7-yl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 25005872) has the molecular formula C38H37FN2O6S and a molecular weight of 668.79 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 25005872 |
| Molecular Formula | C38H37FN2O6S |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | CC1(C)CC2=C(C(c3ccc(OCc4ccccc4)cc3F)N(C(=O)c3cccc4c3OC(C)(C)C4)c3cccc(O)c3N2)S(=O)(=O)C1 |
| InChI | InChI=1S/C38H37FN2O6S/c1-37(2)20-29-35(48(44,45)22-37)33(26-17-16-25(18-28(26)39)46-21-23-10-6-5-7-11-23)41(30-14-9-15-31(42)32(30)40-29)36(43)27-13-8-12-24-19-38(3,4)47-34(24)27/h5-18,33,40,42H,19-22H2,1-4H3 |
| InChIKey | TZISGSRDPFUKBO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|