C22H30N2O — CID 25005968
N-(1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-11-yl)hexanamide (PubChem CID 25005968) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-(1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-11-yl)hexanamide.
| Compound Name | N-(1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-11-yl)hexanamide |
|---|---|
| PubChem CID | 25005968 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-(1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-11-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1cc2c3c(c1)c1c(n3CCC2)CCCCC1 |
| InChI | InChI=1S/C22H30N2O/c1-2-3-5-12-21(25)23-17-14-16-9-8-13-24-20-11-7-4-6-10-18(20)19(15-17)22(16)24/h14-15H,2-13H2,1H3,(H,23,25) |
| InChIKey | SJJHIAVIBLDOQH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|