C15H20BrN3O3 — CID 25006460
tert-butyl N-[2-(6-bromo-1H-indol-3-yl)-2-(hydroxyamino)ethyl]carbamate (PubChem CID 25006460) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is tert-butyl N-[2-(6-bromo-1H-indol-3-yl)-2-(hydroxyamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-bromo-1H-indol-3-yl)-2-(hydroxyamino)ethyl]carbamate |
|---|---|
| PubChem CID | 25006460 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | tert-butyl N-[2-(6-bromo-1H-indol-3-yl)-2-(hydroxyamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(NO)c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C15H20BrN3O3/c1-15(2,3)22-14(20)18-8-13(19-21)11-7-17-12-6-9(16)4-5-10(11)12/h4-7,13,17,19,21H,8H2,1-3H3,(H,18,20) |
| InChIKey | JIJDQZCQZVESSF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|