About 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate
1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate (PubChem CID 25006587) has the molecular formula C20H26N4O3S
and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate |
| PubChem CID | 25006587 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate |
| SMILES | O=C(Nc1nc(NCCO)sc1-c1ccccc1)OCC12CCN(CC1)CC2 |
| InChI | InChI=1S/C20H26N4O3S/c25-13-9-21-18-22-17(16(28-18)15-4-2-1-3-5-15)23-19(26)27-14-20-6-10-24(11-7-20)12-8-20/h1-5,25H,6-14H2,(H,21,22)(H,23,26) |
| InChIKey | PQTRXPDRBGGTJY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate (CID 25006587) is 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate is O=C(Nc1nc(NCCO)sc1-c1ccccc1)OCC12CCN(CC1)CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate?
The InChIKey is PQTRXPDRBGGTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O3S/c25-13-9-21-18-22-17(16(28-18)15-4-2-1-3-5-15)23-19(26)27-14-20-6-10-24(11-7-20)12-8-20/h1-5,25H,6-14H2,(H,21,22)(H,23,26).
What are the key properties of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate?
1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate has a molecular weight of 402.52 g/mol, XLogP of 3.25, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[2-(2-hydroxyethylamino)-5-phenyl-1,3-thiazol-4-yl]carbamate is sourced from PubChem (CID 25006587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).