C28H44O4 — CID 25006983
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 25006983) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 25006983 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C28H44O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(29)30-24-26-25-31-28(2,3)32-26/h5-6,8-9,11-12,14-15,17-18,26H,4,7,10,13,16,19-25H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | JSMZJOWHRQOQEP-AAQCHOMXSA-N |
| XLogP | 7.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|