C21H26N6O4S — CID 25007342
3-(3-aminopropyl)-5-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid (PubChem CID 25007342) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-(3-aminopropyl)-5-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-(3-aminopropyl)-5-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25007342 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-(3-aminopropyl)-5-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid |
| SMILES | CN(C)CCNC(=O)c1csc(NC(=O)c2ccc3[nH]c(C(=O)O)c(CCCN)c3c2)n1 |
| InChI | InChI=1S/C21H26N6O4S/c1-27(2)9-8-23-19(29)16-11-32-21(25-16)26-18(28)12-5-6-15-14(10-12)13(4-3-7-22)17(24-15)20(30)31/h5-6,10-11,24H,3-4,7-9,22H2,1-2H3,(H,23,29)(H,30,31)(H,25,26,28) |
| InChIKey | FQEPUUMAFUDBDT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|