About (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide
(2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide (PubChem CID 25007686) has the molecular formula C23H30F2N2O2
and a molecular weight of 404.50 g/mol. Its IUPAC name is (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide.
Molecular Properties
| Compound Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide |
| PubChem CID | 25007686 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide |
| SMILES | Cc1cc(CCCCCC[C@@H](Nc2cc(C)c(F)c(C)c2)C(=O)NO)ccc1F |
| InChI | InChI=1S/C23H30F2N2O2/c1-15-12-18(10-11-20(15)24)8-6-4-5-7-9-21(23(28)27-29)26-19-13-16(2)22(25)17(3)14-19/h10-14,21,26,29H,4-9H2,1-3H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | PQSAZAVRGIBQJC-OAQYLSRUSA-N |
| XLogP | 5.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide?
The IUPAC name of (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide (CID 25007686) is (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide.
What is the SMILES notation for (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide?
The canonical SMILES for (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide is Cc1cc(CCCCCC[C@@H](Nc2cc(C)c(F)c(C)c2)C(=O)NO)ccc1F.
What is the InChIKey of (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide?
The InChIKey is PQSAZAVRGIBQJC-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H30F2N2O2/c1-15-12-18(10-11-20(15)24)8-6-4-5-7-9-21(23(28)27-29)26-19-13-16(2)22(25)17(3)14-19/h10-14,21,26,29H,4-9H2,1-3H3,(H,27,28)/t21-/m1/s1.
What are the key properties of (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide?
(2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide has a molecular weight of 404.50 g/mol, XLogP of 5.37, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-fluoro-3,5-dimethylanilino)-8-(4-fluoro-3-methylphenyl)-N-hydroxyoctanamide is sourced from PubChem (CID 25007686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).