C27H31F3N2O2 — CID 25007995
(E)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(3,4,5-trifluorophenyl)prop-2-enamide (PubChem CID 25007995) has the molecular formula C27H31F3N2O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is (E)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(3,4,5-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(3,4,5-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 25007995 |
| Molecular Formula | C27H31F3N2O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (E)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]-3-(3,4,5-trifluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(C2CCN(C[C@@H]3CC[C@H](NC(=O)/C=C/c4cc(F)c(F)c(F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C27H31F3N2O2/c1-34-23-7-4-20(5-8-23)21-10-12-32(13-11-21)17-19-2-6-22(14-19)31-26(33)9-3-18-15-24(28)27(30)25(29)16-18/h3-5,7-9,15-16,19,21-22H,2,6,10-14,17H2,1H3,(H,31,33)/b9-3+/t19-,22+/m1/s1 |
| InChIKey | WTRAKJGFQMWFED-DQZIJKFVSA-N |
| XLogP | 5.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|