C27H32F2N2O2 — CID 25007996
(E)-3-(3,5-difluorophenyl)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide (PubChem CID 25007996) has the molecular formula C27H32F2N2O2 and a molecular weight of 454.56 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-difluorophenyl)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 25007996 |
| Molecular Formula | C27H32F2N2O2 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-N-[(1S,3R)-3-[[4-(4-methoxyphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide |
| SMILES | COc1ccc(C2CCN(C[C@@H]3CC[C@H](NC(=O)/C=C/c4cc(F)cc(F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C27H32F2N2O2/c1-33-26-7-4-21(5-8-26)22-10-12-31(13-11-22)18-20-2-6-25(16-20)30-27(32)9-3-19-14-23(28)17-24(29)15-19/h3-5,7-9,14-15,17,20,22,25H,2,6,10-13,16,18H2,1H3,(H,30,32)/b9-3+/t20-,25+/m1/s1 |
| InChIKey | VGGAERSVYZEQQX-SSZUCMNVSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|