C27H25FN2O6 — CID 25008344
(2S,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-3-hydroxypentanoic acid (PubChem CID 25008344) has the molecular formula C27H25FN2O6 and a molecular weight of 492.50 g/mol. Its IUPAC name is (2S,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-3-hydroxypentanoic acid.
| Compound Name | (2S,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 25008344 |
| Molecular Formula | C27H25FN2O6 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (2S,3R)-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-5-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenyl]-3-hydroxypentanoic acid |
| SMILES | COc1ccc(-c2ccc(CC[C@@H](O)[C@H](CCN3C(=O)c4ccccc4C3=O)C(=O)O)c(F)c2)cn1 |
| InChI | InChI=1S/C27H25FN2O6/c1-36-24-11-9-18(15-29-24)17-7-6-16(22(28)14-17)8-10-23(31)21(27(34)35)12-13-30-25(32)19-4-2-3-5-20(19)26(30)33/h2-7,9,11,14-15,21,23,31H,8,10,12-13H2,1H3,(H,34,35)/t21-,23+/m0/s1 |
| InChIKey | VSUHQTLCGGSWSK-JTHBVZDNSA-N |
| XLogP | 3.58 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|