C28H38N2O6S — CID 25009090
1-(4-benzyl-4-hydroxypiperidin-1-yl)-2-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethoxy]ethanone (PubChem CID 25009090) has the molecular formula C28H38N2O6S and a molecular weight of 530.69 g/mol. Its IUPAC name is 1-(4-benzyl-4-hydroxypiperidin-1-yl)-2-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethoxy]ethanone.
| Compound Name | 1-(4-benzyl-4-hydroxypiperidin-1-yl)-2-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethoxy]ethanone |
|---|---|
| PubChem CID | 25009090 |
| Molecular Formula | C28H38N2O6S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-(4-benzyl-4-hydroxypiperidin-1-yl)-2-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethoxy]ethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2CCOCC(=O)N2CCC(O)(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O6S/c1-35-25-10-12-26(13-11-25)37(33,34)30-17-6-5-9-24(30)14-20-36-22-27(31)29-18-15-28(32,16-19-29)21-23-7-3-2-4-8-23/h2-4,7-8,10-13,24,32H,5-6,9,14-22H2,1H3 |
| InChIKey | NKAHJFCPOMJZGT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|