C10H9ClN4S — CID 25009133
7-(4-chlorophenyl)-5,6-dihydro-2H-imidazo[2,1-c][1,2,4]triazole-3-thione (PubChem CID 25009133) has the molecular formula C10H9ClN4S and a molecular weight of 252.73 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-5,6-dihydro-2H-imidazo[2,1-c][1,2,4]triazole-3-thione.
| Compound Name | 7-(4-chlorophenyl)-5,6-dihydro-2H-imidazo[2,1-c][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 25009133 |
| Molecular Formula | C10H9ClN4S |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 7-(4-chlorophenyl)-5,6-dihydro-2H-imidazo[2,1-c][1,2,4]triazole-3-thione |
| SMILES | S=c1[nH]nc2n1CCN2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClN4S/c11-7-1-3-8(4-2-7)14-5-6-15-9(14)12-13-10(15)16/h1-4H,5-6H2,(H,13,16) |
| InChIKey | GXPAIUJQRGQYNJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|