C28H27N5OS — CID 25009146
N-(2-amino-5-thiophen-2-ylphenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide (PubChem CID 25009146) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 25009146 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylpyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC3(CC2)CNc2ccccc23)nc1 |
| InChI | InChI=1S/C28H27N5OS/c29-22-9-7-19(25-6-3-15-35-25)16-24(22)32-27(34)20-8-10-26(30-17-20)33-13-11-28(12-14-33)18-31-23-5-2-1-4-21(23)28/h1-10,15-17,31H,11-14,18,29H2,(H,32,34) |
| InChIKey | YBCAQIYOMLXOOO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|