C22H34O4 — CID 25009281
3-(methoxymethoxy)-4-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-furan-5-one (PubChem CID 25009281) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-(methoxymethoxy)-4-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-furan-5-one.
| Compound Name | 3-(methoxymethoxy)-4-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 25009281 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 3-(methoxymethoxy)-4-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-furan-5-one |
| SMILES | COCOC1=C(C)C(=O)OC1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H34O4/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-20-21(25-15-24-6)19(5)22(23)26-20/h9,11,13,20H,7-8,10,12,14-15H2,1-6H3/b17-11+,18-13+ |
| InChIKey | GJWHDYGHCUPFQS-OUBUNXTGSA-N |
| XLogP | 5.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|