C31H44N4O8S2 — CID 25009776
benzyl N-[4-[(1S,5S,6R,9S,15E,20R)-5-hydroxy-3,8,18,21-tetraoxo-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-en-20-yl]butyl]carbamate (PubChem CID 25009776) has the molecular formula C31H44N4O8S2 and a molecular weight of 664.85 g/mol. Its IUPAC name is benzyl N-[4-[(1S,5S,6R,9S,15E,20R)-5-hydroxy-3,8,18,21-tetraoxo-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-en-20-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(1S,5S,6R,9S,15E,20R)-5-hydroxy-3,8,18,21-tetraoxo-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-en-20-yl]butyl]carbamate |
|---|---|
| PubChem CID | 25009776 |
| Molecular Formula | C31H44N4O8S2 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | benzyl N-[4-[(1S,5S,6R,9S,15E,20R)-5-hydroxy-3,8,18,21-tetraoxo-6-propan-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-en-20-yl]butyl]carbamate |
| SMILES | CC(C)[C@H]1NC(=O)C2CSSCC/C=C/[C@H](CC(=O)N[C@H](CCCCNC(=O)OCc3ccccc3)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C31H44N4O8S2/c1-20(2)28-25(36)17-27(38)43-22-12-7-9-15-44-45-19-24(30(40)35-28)34-29(39)23(33-26(37)16-22)13-6-8-14-32-31(41)42-18-21-10-4-3-5-11-21/h3-5,7,10-12,20,22-25,28,36H,6,8-9,13-19H2,1-2H3,(H,32,41)(H,33,37)(H,34,39)(H,35,40)/b12-7+/t22-,23-,24?,25+,28-/m1/s1 |
| InChIKey | RUIWYIHZZUYFEA-VBYZQPTESA-N |
| XLogP | 2.60 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|