C16H14Cl2FNO4 — CID 25009928
4-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dichlorobenzene-1,2-diol (PubChem CID 25009928) has the molecular formula C16H14Cl2FNO4 and a molecular weight of 374.20 g/mol. Its IUPAC name is 4-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dichlorobenzene-1,2-diol.
| Compound Name | 4-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dichlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 25009928 |
| Molecular Formula | C16H14Cl2FNO4 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dichlorobenzene-1,2-diol |
| SMILES | NC[C@H]1CCc2c(O)c(F)cc(-c3c(Cl)cc(O)c(O)c3Cl)c2O1 |
| InChI | InChI=1S/C16H14Cl2FNO4/c17-9-4-11(21)15(23)13(18)12(9)8-3-10(19)14(22)7-2-1-6(5-20)24-16(7)8/h3-4,6,21-23H,1-2,5,20H2/t6-/m1/s1 |
| InChIKey | HJJUGXMNNVLSQM-ZCFIWIBFSA-N |
| XLogP | 3.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|