C16H14Cl2FNO5 — CID 25010100
5-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-4,6-dichlorobenzene-1,2,3-triol (PubChem CID 25010100) has the molecular formula C16H14Cl2FNO5 and a molecular weight of 390.19 g/mol. Its IUPAC name is 5-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-4,6-dichlorobenzene-1,2,3-triol.
| Compound Name | 5-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-4,6-dichlorobenzene-1,2,3-triol |
|---|---|
| PubChem CID | 25010100 |
| Molecular Formula | C16H14Cl2FNO5 |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 5-[(2R)-2-(aminomethyl)-6-fluoro-5-hydroxy-3,4-dihydro-2H-chromen-8-yl]-4,6-dichlorobenzene-1,2,3-triol |
| SMILES | NC[C@H]1CCc2c(O)c(F)cc(-c3c(Cl)c(O)c(O)c(O)c3Cl)c2O1 |
| InChI | InChI=1S/C16H14Cl2FNO5/c17-10-9(11(18)14(23)15(24)13(10)22)7-3-8(19)12(21)6-2-1-5(4-20)25-16(6)7/h3,5,21-24H,1-2,4,20H2/t5-/m1/s1 |
| InChIKey | PZODHOZCAFTJTC-RXMQYKEDSA-N |
| XLogP | 3.27 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|