C17H15F4NO3 — CID 25010106
4-[(2R)-2-(aminomethyl)-6-fluoro-3,4-dihydro-2H-chromen-8-yl]-5-(trifluoromethyl)benzene-1,2-diol (PubChem CID 25010106) has the molecular formula C17H15F4NO3 and a molecular weight of 357.30 g/mol. Its IUPAC name is 4-[(2R)-2-(aminomethyl)-6-fluoro-3,4-dihydro-2H-chromen-8-yl]-5-(trifluoromethyl)benzene-1,2-diol.
| Compound Name | 4-[(2R)-2-(aminomethyl)-6-fluoro-3,4-dihydro-2H-chromen-8-yl]-5-(trifluoromethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 25010106 |
| Molecular Formula | C17H15F4NO3 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[(2R)-2-(aminomethyl)-6-fluoro-3,4-dihydro-2H-chromen-8-yl]-5-(trifluoromethyl)benzene-1,2-diol |
| SMILES | NC[C@H]1CCc2cc(F)cc(-c3cc(O)c(O)cc3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C17H15F4NO3/c18-9-3-8-1-2-10(7-22)25-16(8)12(4-9)11-5-14(23)15(24)6-13(11)17(19,20)21/h3-6,10,23-24H,1-2,7,22H2/t10-/m1/s1 |
| InChIKey | QTBHTBCTTFLXPI-SNVBAGLBSA-N |
| XLogP | 3.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|