C27H25N3O2 — CID 25010703
4',5'-dimethyl-N-phenylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide (PubChem CID 25010703) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4',5'-dimethyl-N-phenylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide.
| Compound Name | 4',5'-dimethyl-N-phenylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide |
|---|---|
| PubChem CID | 25010703 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4',5'-dimethyl-N-phenylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)Nc4ccccc4)cn2c1C)CCC1(CCc2ccccc21)O3 |
| InChI | InChI=1S/C27H25N3O2/c1-17-18(2)30-16-22(26(31)29-20-9-4-3-5-10-20)21-13-15-27(32-24(21)25(30)28-17)14-12-19-8-6-7-11-23(19)27/h3-11,16H,12-15H2,1-2H3,(H,29,31) |
| InChIKey | LVJLGZMZGUAMKX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |