C20H28F3N3O6 — CID 25010850
ethyl 4-[2-[(3-methoxybenzoyl)amino]ethylamino]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 25010850) has the molecular formula C20H28F3N3O6 and a molecular weight of 463.45 g/mol. Its IUPAC name is ethyl 4-[2-[(3-methoxybenzoyl)amino]ethylamino]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 4-[2-[(3-methoxybenzoyl)amino]ethylamino]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25010850 |
| Molecular Formula | C20H28F3N3O6 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | ethyl 4-[2-[(3-methoxybenzoyl)amino]ethylamino]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)N1CCC(NCCNC(=O)c2cccc(OC)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O4.C2HF3O2/c1-3-25-18(23)21-11-7-15(8-12-21)19-9-10-20-17(22)14-5-4-6-16(13-14)24-2;3-2(4,5)1(6)7/h4-6,13,15,19H,3,7-12H2,1-2H3,(H,20,22);(H,6,7) |
| InChIKey | PLSRIYIFGULCPP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|