C28H39NO2Si — CID 25010990
(2R,3Z,5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one (PubChem CID 25010990) has the molecular formula C28H39NO2Si and a molecular weight of 449.71 g/mol. Its IUPAC name is (2R,3Z,5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one.
| Compound Name | (2R,3Z,5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one |
|---|---|
| PubChem CID | 25010990 |
| Molecular Formula | C28H39NO2Si |
| Molecular Weight | 449.71 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (2R,3Z,5S,6R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one |
| SMILES | CC[C@@H]1CC(=O)N(Cc2ccccc2)[C@@H](c2ccccc2)/C=C\[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H39NO2Si/c1-7-23-20-27(30)29(21-22-14-10-8-11-15-22)25(24-16-12-9-13-17-24)18-19-26(23)31-32(5,6)28(2,3)4/h8-19,23,25-26H,7,20-21H2,1-6H3/b19-18-/t23-,25-,26-/m1/s1 |
| InChIKey | AULNSHBPXHHVJH-UQUFSGSOSA-N |
| XLogP | 7.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|