About 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one
1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one (PubChem CID 25011219) has the molecular formula C18H27NO3S
and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one |
| PubChem CID | 25011219 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one |
| SMILES | CCCCCCCCN1[C@@H](CC(C)=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H27NO3S/c1-3-4-5-6-7-10-13-19-17(14-15(2)20)16-11-8-9-12-18(16)23(19,21)22/h8-9,11-12,17H,3-7,10,13-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | WPUJVUBOUCBJFQ-KRWDZBQOSA-N |
| XLogP | 4.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one?
The IUPAC name of 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one (CID 25011219) is 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one.
What is the SMILES notation for 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one?
The canonical SMILES for 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one is CCCCCCCCN1[C@@H](CC(C)=O)c2ccccc2S1(=O)=O.
What is the InChIKey of 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one?
The InChIKey is WPUJVUBOUCBJFQ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H27NO3S/c1-3-4-5-6-7-10-13-19-17(14-15(2)20)16-11-8-9-12-18(16)23(19,21)22/h8-9,11-12,17H,3-7,10,13-14H2,1-2H3/t17-/m0/s1.
What are the key properties of 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one?
1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one has a molecular weight of 337.49 g/mol, XLogP of 4.07, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one is sourced from PubChem (CID 25011219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).