C18H18F2N2O4S — CID 25011249
methyl 2-[(3S)-2-[4-(dimethylamino)phenyl]-5,7-difluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 25011249) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl 2-[(3S)-2-[4-(dimethylamino)phenyl]-5,7-difluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-2-[4-(dimethylamino)phenyl]-5,7-difluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 25011249 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl 2-[(3S)-2-[4-(dimethylamino)phenyl]-5,7-difluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2cc(F)cc(F)c2S(=O)(=O)N1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H18F2N2O4S/c1-21(2)12-4-6-13(7-5-12)22-16(10-17(23)26-3)14-8-11(19)9-15(20)18(14)27(22,24)25/h4-9,16H,10H2,1-3H3/t16-/m0/s1 |
| InChIKey | HWEKCRKGWPZJPZ-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|