C20H27NO6S — CID 25011454
(E)-3-[(3S)-3-(carboxymethyl)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]prop-2-enoic acid (PubChem CID 25011454) has the molecular formula C20H27NO6S and a molecular weight of 409.50 g/mol. Its IUPAC name is (E)-3-[(3S)-3-(carboxymethyl)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(3S)-3-(carboxymethyl)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25011454 |
| Molecular Formula | C20H27NO6S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (E)-3-[(3S)-3-(carboxymethyl)-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)O)c2ccc(/C=C/C(=O)O)cc2S1(=O)=O |
| InChI | InChI=1S/C20H27NO6S/c1-2-3-4-5-6-7-12-21-17(14-20(24)25)16-10-8-15(9-11-19(22)23)13-18(16)28(21,26)27/h8-11,13,17H,2-7,12,14H2,1H3,(H,22,23)(H,24,25)/b11-9+/t17-/m0/s1 |
| InChIKey | RXXNIINWHCUARN-KAMXEHQASA-N |
| XLogP | 3.66 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|