About 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine
2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine (PubChem CID 25011587) has the molecular formula C21H17NO3
and a molecular weight of 331.37 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine |
| PubChem CID | 25011587 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine |
| SMILES | COc1ccc(-c2oc3cccnc3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H17NO3/c1-23-16-9-5-14(6-10-16)19-20-18(4-3-13-22-20)25-21(19)15-7-11-17(24-2)12-8-15/h3-13H,1-2H3 |
| InChIKey | PFVDGUHWOMUSGP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine?
The IUPAC name of 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine (CID 25011587) is 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine.
What is the SMILES notation for 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine?
The canonical SMILES for 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine is COc1ccc(-c2oc3cccnc3c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine?
The InChIKey is PFVDGUHWOMUSGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO3/c1-23-16-9-5-14(6-10-16)19-20-18(4-3-13-22-20)25-21(19)15-7-11-17(24-2)12-8-15/h3-13H,1-2H3.
What are the key properties of 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine?
2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine has a molecular weight of 331.37 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(4-methoxyphenyl)furo[3,2-b]pyridine is sourced from PubChem (CID 25011587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).