C16H25N5O9S2 — CID 25011780
N-(diaminomethylidene)-2-(2,3-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid (PubChem CID 25011780) has the molecular formula C16H25N5O9S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2,3-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid.
| Compound Name | N-(diaminomethylidene)-2-(2,3-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 25011780 |
| Molecular Formula | C16H25N5O9S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-(diaminomethylidene)-2-(2,3-dimethoxyphenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid |
| SMILES | COc1cccc(-c2nc(C(=O)N=C(N)N)c(C)[nH]2)c1OC.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C14H17N5O3.2CH4O3S/c1-7-10(13(20)19-14(15)16)18-12(17-7)8-5-4-6-9(21-2)11(8)22-3;2*1-5(2,3)4/h4-6H,1-3H3,(H,17,18)(H4,15,16,19,20);2*1H3,(H,2,3,4) |
| InChIKey | WRWFPOSSXMMFGG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 237.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|