C21H16FIN4O2S — CID 25012013
[3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl]-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 25012013) has the molecular formula C21H16FIN4O2S and a molecular weight of 534.35 g/mol. Its IUPAC name is [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl]-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl]-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 25012013 |
| Molecular Formula | C21H16FIN4O2S |
| Molecular Weight | 534.35 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl]-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1oc2ccncc2c1Nc1ccc(I)cc1F)N1CCCC1c1nccs1 |
| InChI | InChI=1S/C21H16FIN4O2S/c22-14-10-12(23)3-4-15(14)26-18-13-11-24-6-5-17(13)29-19(18)21(28)27-8-1-2-16(27)20-25-7-9-30-20/h3-7,9-11,16,26H,1-2,8H2 |
| InChIKey | BYWAVLRNTMTGAL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|