C25H34N6O2 — CID 25012248
N-[(1S,3S)-5-acetamido-2-adamantyl]-1-cyclohexyl-5-pyrazol-1-ylpyrazole-4-carboxamide (PubChem CID 25012248) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[(1S,3S)-5-acetamido-2-adamantyl]-1-cyclohexyl-5-pyrazol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[(1S,3S)-5-acetamido-2-adamantyl]-1-cyclohexyl-5-pyrazol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25012248 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N-[(1S,3S)-5-acetamido-2-adamantyl]-1-cyclohexyl-5-pyrazol-1-ylpyrazole-4-carboxamide |
| SMILES | CC(=O)NC12CC3C[C@@H](C1)C(NC(=O)c1cnn(C4CCCCC4)c1-n1cccn1)[C@@H](C3)C2 |
| InChI | InChI=1S/C25H34N6O2/c1-16(32)29-25-12-17-10-18(13-25)22(19(11-17)14-25)28-23(33)21-15-27-31(20-6-3-2-4-7-20)24(21)30-9-5-8-26-30/h5,8-9,15,17-20,22H,2-4,6-7,10-14H2,1H3,(H,28,33)(H,29,32)/t17?,18-,19-,22?,25?/m0/s1 |
| InChIKey | XNEIGPNMOPMLOR-KDCVGWLPSA-N |
| XLogP | 3.39 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |