C23H34N2O5 — CID 25012597
3-[2-methoxy-5-(1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)phenoxy]propyl N-tert-butylcarbamate (PubChem CID 25012597) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is 3-[2-methoxy-5-(1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)phenoxy]propyl N-tert-butylcarbamate.
| Compound Name | 3-[2-methoxy-5-(1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)phenoxy]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 25012597 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 3-[2-methoxy-5-(1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)phenoxy]propyl N-tert-butylcarbamate |
| SMILES | COc1ccc(C2=NOC3(CCCCC3)C2)cc1OCCCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H34N2O5/c1-22(2,3)24-21(26)29-14-8-13-28-20-15-17(9-10-19(20)27-4)18-16-23(30-25-18)11-6-5-7-12-23/h9-10,15H,5-8,11-14,16H2,1-4H3,(H,24,26) |
| InChIKey | SFEGLBARXRWYAB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|