About [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate
[4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate (PubChem CID 25012787) has the molecular formula C20H20N4O2
and a molecular weight of 348.41 g/mol. Its IUPAC name is [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate |
| PubChem CID | 25012787 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCc1ccc(-c2cnc3[nH]cc(C#N)c3c2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-20(2,3)24-19(25)26-12-13-4-6-14(7-5-13)15-8-17-16(9-21)11-23-18(17)22-10-15/h4-8,10-11H,12H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | AQPUKZPSKMYRQE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate?
The IUPAC name of [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate (CID 25012787) is [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate.
What is the SMILES notation for [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate?
The canonical SMILES for [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCc1ccc(-c2cnc3[nH]cc(C#N)c3c2)cc1.
What is the InChIKey of [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate?
The InChIKey is AQPUKZPSKMYRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O2/c1-20(2,3)24-19(25)26-12-13-4-6-14(7-5-13)15-8-17-16(9-21)11-23-18(17)22-10-15/h4-8,10-11H,12H2,1-3H3,(H,22,23)(H,24,25).
What are the key properties of [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate?
[4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate has a molecular weight of 348.41 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-cyano-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl N-tert-butylcarbamate is sourced from PubChem (CID 25012787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).