C18H22O3 — CID 25013170
(2R,3aS,9aS)-2-methyl-2-phenylmethoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 25013170) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-methyl-2-phenylmethoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (2R,3aS,9aS)-2-methyl-2-phenylmethoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 25013170 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2R,3aS,9aS)-2-methyl-2-phenylmethoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | C[C@]1(OCc2ccccc2)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C18H22O3/c1-17(20-12-14-7-3-2-4-8-14)11-16-18(21-17)10-6-5-9-15(18)13-19-16/h2-4,7-9,16H,5-6,10-13H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | YBZMCIMUOYQKNG-KSZLIROESA-N |
| XLogP | 3.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|