C13H20O3 — CID 25013173
(2R,3aS,9aS)-2-ethoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 25013173) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-ethoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (2R,3aS,9aS)-2-ethoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 25013173 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2R,3aS,9aS)-2-ethoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CCO[C@@]1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C13H20O3/c1-3-15-12(2)8-11-13(16-12)7-5-4-6-10(13)9-14-11/h6,11H,3-5,7-9H2,1-2H3/t11-,12+,13-/m0/s1 |
| InChIKey | WPCXNALFBKKRJT-XQQFMLRXSA-N |
| XLogP | 2.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|