C15H24O3 — CID 25013176
(2R,3aS,9aS)-2-butoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 25013176) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-butoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (2R,3aS,9aS)-2-butoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 25013176 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2R,3aS,9aS)-2-butoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CCCCO[C@@]1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C15H24O3/c1-3-4-9-17-14(2)10-13-15(18-14)8-6-5-7-12(15)11-16-13/h7,13H,3-6,8-11H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | BBZQHDCBJJBVBU-ZNMIVQPWSA-N |
| XLogP | 3.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|