C23H32N6O2 — CID 25013379
N-[(1S,3S)-5-acetamido-2-adamantyl]-1-tert-butyl-5-pyrazol-1-ylpyrazole-4-carboxamide (PubChem CID 25013379) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(1S,3S)-5-acetamido-2-adamantyl]-1-tert-butyl-5-pyrazol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[(1S,3S)-5-acetamido-2-adamantyl]-1-tert-butyl-5-pyrazol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25013379 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-[(1S,3S)-5-acetamido-2-adamantyl]-1-tert-butyl-5-pyrazol-1-ylpyrazole-4-carboxamide |
| SMILES | CC(=O)NC12CC3C[C@@H](C1)C(NC(=O)c1cnn(C(C)(C)C)c1-n1cccn1)[C@@H](C3)C2 |
| InChI | InChI=1S/C23H32N6O2/c1-14(30)27-23-10-15-8-16(11-23)19(17(9-15)12-23)26-20(31)18-13-25-29(22(2,3)4)21(18)28-7-5-6-24-28/h5-7,13,15-17,19H,8-12H2,1-4H3,(H,26,31)(H,27,30)/t15?,16-,17-,19?,23?/m0/s1 |
| InChIKey | SRGPTBBGNULGBM-RFOZUXPWSA-N |
| XLogP | 2.64 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |