About N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide
N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide (PubChem CID 25014206) has the molecular formula C29H24FN3O2
and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide |
| PubChem CID | 25014206 |
| Molecular Formula | C29H24FN3O2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1)[C@H](Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H24FN3O2/c1-20(32-29(34)22-10-6-3-7-11-22)28(21-8-4-2-5-9-21)35-26-16-17-27-23(18-26)19-31-33(27)25-14-12-24(30)13-15-25/h2-20,28H,1H3,(H,32,34)/t20-,28-/m0/s1 |
| InChIKey | PBVAUALHFQEWGB-MMTVBGGISA-N |
| XLogP | 6.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide?
The IUPAC name of N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide (CID 25014206) is N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide.
What is the SMILES notation for N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide?
The canonical SMILES for N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide is C[C@H](NC(=O)c1ccccc1)[C@H](Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1ccccc1.
What is the InChIKey of N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide?
The InChIKey is PBVAUALHFQEWGB-MMTVBGGISA-N. The full InChI is InChI=1S/C29H24FN3O2/c1-20(32-29(34)22-10-6-3-7-11-22)28(21-8-4-2-5-9-21)35-26-16-17-27-23(18-26)19-31-33(27)25-14-12-24(30)13-15-25/h2-20,28H,1H3,(H,32,34)/t20-,28-/m0/s1.
What are the key properties of N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide?
N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide has a molecular weight of 465.53 g/mol, XLogP of 6.10, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-phenylpropan-2-yl]benzamide is sourced from PubChem (CID 25014206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).