C24H23Cl2N7O2 — CID 25014241
8-(2,6-dichlorophenyl)-N-[(3-nitrophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine (PubChem CID 25014241) has the molecular formula C24H23Cl2N7O2 and a molecular weight of 512.40 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-N-[(3-nitrophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine.
| Compound Name | 8-(2,6-dichlorophenyl)-N-[(3-nitrophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 25014241 |
| Molecular Formula | C24H23Cl2N7O2 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-N-[(3-nitrophenyl)methyl]-9-[[(3R)-piperidin-3-yl]methyl]purin-2-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2ncc3nc(-c4c(Cl)cccc4Cl)n(C[C@@H]4CCCNC4)c3n2)c1 |
| InChI | InChI=1S/C24H23Cl2N7O2/c25-18-7-2-8-19(26)21(18)23-30-20-13-29-24(28-12-15-4-1-6-17(10-15)33(34)35)31-22(20)32(23)14-16-5-3-9-27-11-16/h1-2,4,6-8,10,13,16,27H,3,5,9,11-12,14H2,(H,28,29,31)/t16-/m1/s1 |
| InChIKey | RBBVNRZPDDIXTB-MRXNPFEDSA-N |
| XLogP | 5.32 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|