C21H29F2N5O2 — CID 25014543
(5S)-5-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one (PubChem CID 25014543) has the molecular formula C21H29F2N5O2 and a molecular weight of 421.49 g/mol. Its IUPAC name is (5S)-5-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25014543 |
| Molecular Formula | C21H29F2N5O2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (5S)-5-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-1-[6-(2H-tetrazol-5-yl)hexyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CC[C@@H](O)C(F)(F)c2ccccc2)N1CCCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C21H29F2N5O2/c22-21(23,16-8-4-3-5-9-16)18(29)13-11-17-12-14-20(30)28(17)15-7-2-1-6-10-19-24-26-27-25-19/h3-5,8-9,17-18,29H,1-2,6-7,10-15H2,(H,24,25,26,27)/t17-,18+/m0/s1 |
| InChIKey | ZFXWQALCLYEUAK-ZWKOTPCHSA-N |
| XLogP | 3.23 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|