About 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide
2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide (PubChem CID 25014612) has the molecular formula C22H26N2O5
and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
| PubChem CID | 25014612 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)Nc1cccc(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N2O5/c25-22(14-17-5-6-20-21(13-17)29-16-28-20)23-18-3-1-4-19(15-18)27-10-2-7-24-8-11-26-12-9-24/h1,3-6,13,15H,2,7-12,14,16H2,(H,23,25) |
| InChIKey | QIAFBTIJFNZMQI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide (CID 25014612) is 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide is O=C(Cc1ccc2c(c1)OCO2)Nc1cccc(OCCCN2CCOCC2)c1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The InChIKey is QIAFBTIJFNZMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O5/c25-22(14-17-5-6-20-21(13-17)29-16-28-20)23-18-3-1-4-19(15-18)27-10-2-7-24-8-11-26-12-9-24/h1,3-6,13,15H,2,7-12,14,16H2,(H,23,25).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide has a molecular weight of 398.46 g/mol, XLogP of 2.70, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide is sourced from PubChem (CID 25014612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).