About 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide
2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide (PubChem CID 25014614) has the molecular formula C21H24F2N2O3
and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
| PubChem CID | 25014614 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)Nc1cccc(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H24F2N2O3/c22-19-6-5-16(13-20(19)23)14-21(26)24-17-3-1-4-18(15-17)28-10-2-7-25-8-11-27-12-9-25/h1,3-6,13,15H,2,7-12,14H2,(H,24,26) |
| InChIKey | MZFDSZMNKUJMAC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The IUPAC name of 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide (CID 25014614) is 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide.
What is the SMILES notation for 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The canonical SMILES for 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide is O=C(Cc1ccc(F)c(F)c1)Nc1cccc(OCCCN2CCOCC2)c1.
What is the InChIKey of 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
The InChIKey is MZFDSZMNKUJMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2O3/c22-19-6-5-16(13-20(19)23)14-21(26)24-17-3-1-4-18(15-17)28-10-2-7-25-8-11-27-12-9-25/h1,3-6,13,15H,2,7-12,14H2,(H,24,26).
What are the key properties of 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide?
2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide has a molecular weight of 390.43 g/mol, XLogP of 3.25, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]acetamide is sourced from PubChem (CID 25014614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).