About 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline (PubChem CID 25014635) has the molecular formula C18H20N4O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline.
Molecular Properties
| Compound Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline |
| PubChem CID | 25014635 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline |
| SMILES | COc1ccc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C18H20N4O4/c1-23-15-6-5-11(7-13(15)19)14-10-20-21-22(14)12-8-16(24-2)18(26-4)17(9-12)25-3/h5-10H,19H2,1-4H3 |
| InChIKey | VKMMSKMOFCQNBK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline?
The IUPAC name of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline (CID 25014635) is 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline.
What is the SMILES notation for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline?
The canonical SMILES for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline is COc1ccc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)cc1N.
What is the InChIKey of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline?
The InChIKey is VKMMSKMOFCQNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O4/c1-23-15-6-5-11(7-13(15)19)14-10-20-21-22(14)12-8-16(24-2)18(26-4)17(9-12)25-3/h5-10H,19H2,1-4H3.
What are the key properties of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline?
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline has a molecular weight of 356.38 g/mol, XLogP of 2.55, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]aniline is sourced from PubChem (CID 25014635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).