About 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine
3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine (PubChem CID 25014649) has the molecular formula C10H9ClN8
and a molecular weight of 276.69 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine |
| PubChem CID | 25014649 |
| Molecular Formula | C10H9ClN8 |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine |
| SMILES | [H]/N=c1\c2nnn(Cc3ccc(Cl)nc3)c2ncn1N |
| InChI | InChI=1S/C10H9ClN8/c11-7-2-1-6(3-14-7)4-19-10-8(16-17-19)9(12)18(13)5-15-10/h1-3,5,12H,4,13H2/b12-9+ |
| InChIKey | YEBXFJPURFLRTJ-FMIVXFBMSA-N |
| XLogP | -0.08 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine?
The IUPAC name of 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine (CID 25014649) is 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine.
What is the SMILES notation for 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine?
The canonical SMILES for 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine is [H]/N=c1\c2nnn(Cc3ccc(Cl)nc3)c2ncn1N.
What is the InChIKey of 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine?
The InChIKey is YEBXFJPURFLRTJ-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H9ClN8/c11-7-2-1-6(3-14-7)4-19-10-8(16-17-19)9(12)18(13)5-15-10/h1-3,5,12H,4,13H2/b12-9+.
What are the key properties of 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine?
3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine has a molecular weight of 276.69 g/mol, XLogP of -0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-3-pyridinyl)methyl]-7-iminotriazolo[4,5-d]pyrimidin-6-amine is sourced from PubChem (CID 25014649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).