C20H24ClN3O3 — CID 25014696
1-(4-chlorophenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea (PubChem CID 25014696) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 25014696 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C20H24ClN3O3/c21-16-5-7-17(8-6-16)22-20(25)23-18-3-1-4-19(15-18)27-12-2-9-24-10-13-26-14-11-24/h1,3-8,15H,2,9-14H2,(H2,22,23,25) |
| InChIKey | ZRAKMKLASRCXJL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|