C25H30N6O2 — CID 25014762
2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-methyl-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 25014762) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-methyl-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-methyl-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25014762 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-methyl-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | CN(c1ccccc1)c1ccnc(Nc2cc(N3CCOCC3)cc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C25H30N6O2/c1-29(21-5-3-2-4-6-21)24-7-8-26-25(28-24)27-20-17-22(30-9-13-32-14-10-30)19-23(18-20)31-11-15-33-16-12-31/h2-8,17-19H,9-16H2,1H3,(H,26,27,28) |
| InChIKey | SPIWOLIEUWRHGI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |