About 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid
4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 25014973) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid |
| PubChem CID | 25014973 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | C/C(=C\CC[C@H](C)C(=O)O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H24O4/c1-10(4-3-5-11(2)14(16)17)12-6-8-13(9-7-12)15(18)19/h4,11-13H,3,5-9H2,1-2H3,(H,16,17)(H,18,19)/b10-4+/t11-,12?,13?/m0/s1 |
| InChIKey | LTNNRLSIPOPBOC-AIPMOWSPSA-N |
| XLogP | 3.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid (CID 25014973) is 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid is C/C(=C\CC[C@H](C)C(=O)O)C1CCC(C(=O)O)CC1.
What is the InChIKey of 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid?
The InChIKey is LTNNRLSIPOPBOC-AIPMOWSPSA-N. The full InChI is InChI=1S/C15H24O4/c1-10(4-3-5-11(2)14(16)17)12-6-8-13(9-7-12)15(18)19/h4,11-13H,3,5-9H2,1-2H3,(H,16,17)(H,18,19)/b10-4+/t11-,12?,13?/m0/s1.
What are the key properties of 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid?
4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid has a molecular weight of 268.35 g/mol, XLogP of 3.32, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,6S)-6-carboxyhept-2-en-2-yl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 25014973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).